C14H21ClN2O — CID 114927846
N-[[5-chloro-2-(cyclopropylmethoxy)-4-pyridinyl]methyl]-2-methylpropan-1-amine (PubChem CID 114927846) has the molecular formula C14H21ClN2O and a molecular weight of 268.79 g/mol. Its IUPAC name is N-[[5-chloro-2-(cyclopropylmethoxy)-4-pyridinyl]methyl]-2-methylpropan-1-amine.
| Compound Name | N-[[5-chloro-2-(cyclopropylmethoxy)-4-pyridinyl]methyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 114927846 |
| Molecular Formula | C14H21ClN2O |
| Molecular Weight | 268.79 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | N-[[5-chloro-2-(cyclopropylmethoxy)-4-pyridinyl]methyl]-2-methylpropan-1-amine |
| SMILES | CC(C)CNCc1cc(OCC2CC2)ncc1Cl |
| InChI | InChI=1S/C14H21ClN2O/c1-10(2)6-16-7-12-5-14(17-8-13(12)15)18-9-11-3-4-11/h5,8,10-11,16H,3-4,6-7,9H2,1-2H3 |
| InChIKey | ZKDBBVIYIRRJAR-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.79 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |