C17H27ClN2O — CID 114928593
N-[[5-chloro-2-(cyclohexylmethoxy)-4-pyridinyl]methyl]-2-methylpropan-2-amine (PubChem CID 114928593) has the molecular formula C17H27ClN2O and a molecular weight of 310.87 g/mol. Its IUPAC name is N-[[5-chloro-2-(cyclohexylmethoxy)-4-pyridinyl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[5-chloro-2-(cyclohexylmethoxy)-4-pyridinyl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 114928593 |
| Molecular Formula | C17H27ClN2O |
| Molecular Weight | 310.87 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | N-[[5-chloro-2-(cyclohexylmethoxy)-4-pyridinyl]methyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)NCc1cc(OCC2CCCCC2)ncc1Cl |
| InChI | InChI=1S/C17H27ClN2O/c1-17(2,3)20-10-14-9-16(19-11-15(14)18)21-12-13-7-5-4-6-8-13/h9,11,13,20H,4-8,10,12H2,1-3H3 |
| InChIKey | XQGHUNMFFKNAFC-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.87 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |