C15H25ClN2O — CID 114927691
N-[[5-chloro-2-(3-methylbutoxy)-4-pyridinyl]methyl]-2-methylpropan-2-amine (PubChem CID 114927691) has the molecular formula C15H25ClN2O and a molecular weight of 284.83 g/mol. Its IUPAC name is N-[[5-chloro-2-(3-methylbutoxy)-4-pyridinyl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[5-chloro-2-(3-methylbutoxy)-4-pyridinyl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 114927691 |
| Molecular Formula | C15H25ClN2O |
| Molecular Weight | 284.83 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | N-[[5-chloro-2-(3-methylbutoxy)-4-pyridinyl]methyl]-2-methylpropan-2-amine |
| SMILES | CC(C)CCOc1cc(CNC(C)(C)C)c(Cl)cn1 |
| InChI | InChI=1S/C15H25ClN2O/c1-11(2)6-7-19-14-8-12(13(16)10-17-14)9-18-15(3,4)5/h8,10-11,18H,6-7,9H2,1-5H3 |
| InChIKey | ZRYNFAFQDXNFPM-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.83 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |