C13H21ClN2O — CID 114927869
N-[(5-chloro-2-propoxy-4-pyridinyl)methyl]-2-methylpropan-2-amine (PubChem CID 114927869) has the molecular formula C13H21ClN2O and a molecular weight of 256.78 g/mol. Its IUPAC name is N-[(5-chloro-2-propoxy-4-pyridinyl)methyl]-2-methylpropan-2-amine.
| Compound Name | N-[(5-chloro-2-propoxy-4-pyridinyl)methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 114927869 |
| Molecular Formula | C13H21ClN2O |
| Molecular Weight | 256.78 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | N-[(5-chloro-2-propoxy-4-pyridinyl)methyl]-2-methylpropan-2-amine |
| SMILES | CCCOc1cc(CNC(C)(C)C)c(Cl)cn1 |
| InChI | InChI=1S/C13H21ClN2O/c1-5-6-17-12-7-10(11(14)9-15-12)8-16-13(2,3)4/h7,9,16H,5-6,8H2,1-4H3 |
| InChIKey | HULZTLRGYJPUKD-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.78 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |