C14H21ClN2O — CID 114928877
N-[(5-chloro-2-pent-4-enoxy-4-pyridinyl)methyl]propan-1-amine (PubChem CID 114928877) has the molecular formula C14H21ClN2O and a molecular weight of 268.79 g/mol. Its IUPAC name is N-[(5-chloro-2-pent-4-enoxy-4-pyridinyl)methyl]propan-1-amine.
| Compound Name | N-[(5-chloro-2-pent-4-enoxy-4-pyridinyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 114928877 |
| Molecular Formula | C14H21ClN2O |
| Molecular Weight | 268.79 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | N-[(5-chloro-2-pent-4-enoxy-4-pyridinyl)methyl]propan-1-amine |
| SMILES | C=CCCCOc1cc(CNCCC)c(Cl)cn1 |
| InChI | InChI=1S/C14H21ClN2O/c1-3-5-6-8-18-14-9-12(10-16-7-4-2)13(15)11-17-14/h3,9,11,16H,1,4-8,10H2,2H3 |
| InChIKey | LIDUJPMBLGOZDA-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.79 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|