C15H14F2N2O2 — CID 114930488
2-[2-amino-N-[(2,6-difluorophenyl)methyl]anilino]acetic acid (PubChem CID 114930488) has the molecular formula C15H14F2N2O2 and a molecular weight of 292.29 g/mol. Its IUPAC name is 2-[2-amino-N-[(2,6-difluorophenyl)methyl]anilino]acetic acid.
| Compound Name | 2-[2-amino-N-[(2,6-difluorophenyl)methyl]anilino]acetic acid |
|---|---|
| PubChem CID | 114930488 |
| Molecular Formula | C15H14F2N2O2 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 2-[2-amino-N-[(2,6-difluorophenyl)methyl]anilino]acetic acid |
| SMILES | Nc1ccccc1N(CC(=O)O)Cc1c(F)cccc1F |
| InChI | InChI=1S/C15H14F2N2O2/c16-11-4-3-5-12(17)10(11)8-19(9-15(20)21)14-7-2-1-6-13(14)18/h1-7H,8-9,18H2,(H,20,21) |
| InChIKey | ZCMLDWHKFUPTCC-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|