C15H11BrF2O2 — CID 114930828
2-(3-bromophenyl)-3-(2,6-difluorophenyl)propanoic acid (PubChem CID 114930828) has the molecular formula C15H11BrF2O2 and a molecular weight of 341.15 g/mol. Its IUPAC name is 2-(3-bromophenyl)-3-(2,6-difluorophenyl)propanoic acid.
| Compound Name | 2-(3-bromophenyl)-3-(2,6-difluorophenyl)propanoic acid |
|---|---|
| PubChem CID | 114930828 |
| Molecular Formula | C15H11BrF2O2 |
| Molecular Weight | 341.15 g/mol |
| Exact Mass | 339.99 |
| IUPAC Name | 2-(3-bromophenyl)-3-(2,6-difluorophenyl)propanoic acid |
| SMILES | O=C(O)C(Cc1c(F)cccc1F)c1cccc(Br)c1 |
| InChI | InChI=1S/C15H11BrF2O2/c16-10-4-1-3-9(7-10)11(15(19)20)8-12-13(17)5-2-6-14(12)18/h1-7,11H,8H2,(H,19,20) |
| InChIKey | LTFREPUVKMTJJS-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.15 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |