C11H11BrO4 — CID 82160246
2-(3-bromophenyl)pentanedioic acid (PubChem CID 82160246) has the molecular formula C11H11BrO4 and a molecular weight of 287.11 g/mol. Its IUPAC name is 2-(3-bromophenyl)pentanedioic acid.
| Compound Name | 2-(3-bromophenyl)pentanedioic acid |
|---|---|
| PubChem CID | 82160246 |
| Molecular Formula | C11H11BrO4 |
| Molecular Weight | 287.11 g/mol |
| Exact Mass | 285.98 |
| IUPAC Name | 2-(3-bromophenyl)pentanedioic acid |
| SMILES | O=C(O)CCC(C(=O)O)c1cccc(Br)c1 |
| InChI | InChI=1S/C11H11BrO4/c12-8-3-1-2-7(6-8)9(11(15)16)4-5-10(13)14/h1-3,6,9H,4-5H2,(H,13,14)(H,15,16) |
| InChIKey | KBNIYTPCUSOTCR-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.11 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |