C17H13F2NO — CID 114931016
2-(2,6-difluorophenyl)-1-quinolin-4-ylethanol (PubChem CID 114931016) has the molecular formula C17H13F2NO and a molecular weight of 285.29 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-1-quinolin-4-ylethanol.
| Compound Name | 2-(2,6-difluorophenyl)-1-quinolin-4-ylethanol |
|---|---|
| PubChem CID | 114931016 |
| Molecular Formula | C17H13F2NO |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 2-(2,6-difluorophenyl)-1-quinolin-4-ylethanol |
| SMILES | OC(Cc1c(F)cccc1F)c1ccnc2ccccc12 |
| InChI | InChI=1S/C17H13F2NO/c18-14-5-3-6-15(19)13(14)10-17(21)12-8-9-20-16-7-2-1-4-11(12)16/h1-9,17,21H,10H2 |
| InChIKey | HAFIFPPTTFSWOM-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |