C14H21F2NO — CID 114931570
4-(diethylamino)-1-(2,6-difluorophenyl)butan-2-ol (PubChem CID 114931570) has the molecular formula C14H21F2NO and a molecular weight of 257.32 g/mol. Its IUPAC name is 4-(diethylamino)-1-(2,6-difluorophenyl)butan-2-ol.
| Compound Name | 4-(diethylamino)-1-(2,6-difluorophenyl)butan-2-ol |
|---|---|
| PubChem CID | 114931570 |
| Molecular Formula | C14H21F2NO |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 4-(diethylamino)-1-(2,6-difluorophenyl)butan-2-ol |
| SMILES | CCN(CC)CCC(O)Cc1c(F)cccc1F |
| InChI | InChI=1S/C14H21F2NO/c1-3-17(4-2)9-8-11(18)10-12-13(15)6-5-7-14(12)16/h5-7,11,18H,3-4,8-10H2,1-2H3 |
| InChIKey | VZROAFNOABHALM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |