C11H13ClF2O — CID 114933132
2-(3-chloro-4-methoxybutyl)-1,3-difluorobenzene (PubChem CID 114933132) has the molecular formula C11H13ClF2O and a molecular weight of 234.67 g/mol. Its IUPAC name is 2-(3-chloro-4-methoxybutyl)-1,3-difluorobenzene.
| Compound Name | 2-(3-chloro-4-methoxybutyl)-1,3-difluorobenzene |
|---|---|
| PubChem CID | 114933132 |
| Molecular Formula | C11H13ClF2O |
| Molecular Weight | 234.67 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | 2-(3-chloro-4-methoxybutyl)-1,3-difluorobenzene |
| SMILES | COCC(Cl)CCc1c(F)cccc1F |
| InChI | InChI=1S/C11H13ClF2O/c1-15-7-8(12)5-6-9-10(13)3-2-4-11(9)14/h2-4,8H,5-7H2,1H3 |
| InChIKey | UHRJKHMSNUHIDY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.67 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|