C12H16ClF2NO — CID 106242412
3-chloro-N-[(2,6-difluorophenyl)methyl]-4-methoxybutan-1-amine (PubChem CID 106242412) has the molecular formula C12H16ClF2NO and a molecular weight of 263.71 g/mol. Its IUPAC name is 3-chloro-N-[(2,6-difluorophenyl)methyl]-4-methoxybutan-1-amine.
| Compound Name | 3-chloro-N-[(2,6-difluorophenyl)methyl]-4-methoxybutan-1-amine |
|---|---|
| PubChem CID | 106242412 |
| Molecular Formula | C12H16ClF2NO |
| Molecular Weight | 263.71 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 3-chloro-N-[(2,6-difluorophenyl)methyl]-4-methoxybutan-1-amine |
| SMILES | COCC(Cl)CCNCc1c(F)cccc1F |
| InChI | InChI=1S/C12H16ClF2NO/c1-17-8-9(13)5-6-16-7-10-11(14)3-2-4-12(10)15/h2-4,9,16H,5-8H2,1H3 |
| InChIKey | KNJXYNJCKNJWST-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.71 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|