C11H15F2NO — CID 96500088
(2S)-4-[(2,6-difluorophenyl)methylamino]butan-2-ol (PubChem CID 96500088) has the molecular formula C11H15F2NO and a molecular weight of 215.24 g/mol. Its IUPAC name is (2S)-4-[(2,6-difluorophenyl)methylamino]butan-2-ol.
| Compound Name | (2S)-4-[(2,6-difluorophenyl)methylamino]butan-2-ol |
|---|---|
| PubChem CID | 96500088 |
| Molecular Formula | C11H15F2NO |
| Molecular Weight | 215.24 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | (2S)-4-[(2,6-difluorophenyl)methylamino]butan-2-ol |
| SMILES | C[C@H](O)CCNCc1c(F)cccc1F |
| InChI | InChI=1S/C11H15F2NO/c1-8(15)5-6-14-7-9-10(12)3-2-4-11(9)13/h2-4,8,14-15H,5-7H2,1H3/t8-/m0/s1 |
| InChIKey | JHASUROHZORHBA-QMMMGPOBSA-N |
| XLogP | 1.83 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.24 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|