C12H17F2N — CID 114933384
2-[(2,6-difluorophenyl)methyl]-N-methylbutan-1-amine (PubChem CID 114933384) has the molecular formula C12H17F2N and a molecular weight of 213.27 g/mol. Its IUPAC name is 2-[(2,6-difluorophenyl)methyl]-N-methylbutan-1-amine.
| Compound Name | 2-[(2,6-difluorophenyl)methyl]-N-methylbutan-1-amine |
|---|---|
| PubChem CID | 114933384 |
| Molecular Formula | C12H17F2N |
| Molecular Weight | 213.27 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 2-[(2,6-difluorophenyl)methyl]-N-methylbutan-1-amine |
| SMILES | CCC(CNC)Cc1c(F)cccc1F |
| InChI | InChI=1S/C12H17F2N/c1-3-9(8-15-2)7-10-11(13)5-4-6-12(10)14/h4-6,9,15H,3,7-8H2,1-2H3 |
| InChIKey | ALUIPPGPTDLQTB-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.27 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |