C17H18ClF2N — CID 114933720
2-(4-chlorophenyl)-3-(2,6-difluorophenyl)-N-ethylpropan-1-amine (PubChem CID 114933720) has the molecular formula C17H18ClF2N and a molecular weight of 309.79 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-3-(2,6-difluorophenyl)-N-ethylpropan-1-amine.
| Compound Name | 2-(4-chlorophenyl)-3-(2,6-difluorophenyl)-N-ethylpropan-1-amine |
|---|---|
| PubChem CID | 114933720 |
| Molecular Formula | C17H18ClF2N |
| Molecular Weight | 309.79 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 2-(4-chlorophenyl)-3-(2,6-difluorophenyl)-N-ethylpropan-1-amine |
| SMILES | CCNCC(Cc1c(F)cccc1F)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H18ClF2N/c1-2-21-11-13(12-6-8-14(18)9-7-12)10-15-16(19)4-3-5-17(15)20/h3-9,13,21H,2,10-11H2,1H3 |
| InChIKey | VJSJGXKUBKITFJ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.79 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |