C17H19Cl2N — CID 65429482
3-(2,6-dichlorophenyl)-N-ethyl-2-phenylpropan-1-amine (PubChem CID 65429482) has the molecular formula C17H19Cl2N and a molecular weight of 308.25 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-N-ethyl-2-phenylpropan-1-amine.
| Compound Name | 3-(2,6-dichlorophenyl)-N-ethyl-2-phenylpropan-1-amine |
|---|---|
| PubChem CID | 65429482 |
| Molecular Formula | C17H19Cl2N |
| Molecular Weight | 308.25 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-N-ethyl-2-phenylpropan-1-amine |
| SMILES | CCNCC(Cc1c(Cl)cccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C17H19Cl2N/c1-2-20-12-14(13-7-4-3-5-8-13)11-15-16(18)9-6-10-17(15)19/h3-10,14,20H,2,11-12H2,1H3 |
| InChIKey | CAQKOWNXMPKXLA-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.25 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |