C15H12F3N3 — CID 114933426
5,7-dimethyl-2-(3,4,5-trifluorophenyl)imidazo[1,2-a]pyridin-3-amine (PubChem CID 114933426) has the molecular formula C15H12F3N3 and a molecular weight of 291.28 g/mol. Its IUPAC name is 5,7-dimethyl-2-(3,4,5-trifluorophenyl)imidazo[1,2-a]pyridin-3-amine.
| Compound Name | 5,7-dimethyl-2-(3,4,5-trifluorophenyl)imidazo[1,2-a]pyridin-3-amine |
|---|---|
| PubChem CID | 114933426 |
| Molecular Formula | C15H12F3N3 |
| Molecular Weight | 291.28 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 5,7-dimethyl-2-(3,4,5-trifluorophenyl)imidazo[1,2-a]pyridin-3-amine |
| SMILES | Cc1cc(C)n2c(N)c(-c3cc(F)c(F)c(F)c3)nc2c1 |
| InChI | InChI=1S/C15H12F3N3/c1-7-3-8(2)21-12(4-7)20-14(15(21)19)9-5-10(16)13(18)11(17)6-9/h3-6H,19H2,1-2H3 |
| InChIKey | PHFNJITVWCXCQY-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.28 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|