C13H8F3N3 — CID 63618084
2-(3,4,5-trifluorophenyl)imidazo[1,2-a]pyridin-3-amine (PubChem CID 63618084) has the molecular formula C13H8F3N3 and a molecular weight of 263.22 g/mol. Its IUPAC name is 2-(3,4,5-trifluorophenyl)imidazo[1,2-a]pyridin-3-amine.
| Compound Name | 2-(3,4,5-trifluorophenyl)imidazo[1,2-a]pyridin-3-amine |
|---|---|
| PubChem CID | 63618084 |
| Molecular Formula | C13H8F3N3 |
| Molecular Weight | 263.22 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 2-(3,4,5-trifluorophenyl)imidazo[1,2-a]pyridin-3-amine |
| SMILES | Nc1c(-c2cc(F)c(F)c(F)c2)nc2ccccn12 |
| InChI | InChI=1S/C13H8F3N3/c14-8-5-7(6-9(15)11(8)16)12-13(17)19-4-2-1-3-10(19)18-12/h1-6H,17H2 |
| InChIKey | JEQKAAVJYONKQL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.22 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|