C13H17BrF2 — CID 114934494
2-(4-bromoheptyl)-1,3-difluorobenzene (PubChem CID 114934494) has the molecular formula C13H17BrF2 and a molecular weight of 291.18 g/mol. Its IUPAC name is 2-(4-bromoheptyl)-1,3-difluorobenzene.
| Compound Name | 2-(4-bromoheptyl)-1,3-difluorobenzene |
|---|---|
| PubChem CID | 114934494 |
| Molecular Formula | C13H17BrF2 |
| Molecular Weight | 291.18 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 2-(4-bromoheptyl)-1,3-difluorobenzene |
| SMILES | CCCC(Br)CCCc1c(F)cccc1F |
| InChI | InChI=1S/C13H17BrF2/c1-2-5-10(14)6-3-7-11-12(15)8-4-9-13(11)16/h4,8-10H,2-3,5-7H2,1H3 |
| InChIKey | VOUDWAPJVQAJDQ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.18 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|