C15H19ClF3NO — CID 11493508
4-[4-chloro-3-(trifluoromethyl)phenyl]-1-propylpiperidin-4-ol (PubChem CID 11493508) has the molecular formula C15H19ClF3NO and a molecular weight of 321.77 g/mol. Its IUPAC name is 4-[4-chloro-3-(trifluoromethyl)phenyl]-1-propylpiperidin-4-ol.
| Compound Name | 4-[4-chloro-3-(trifluoromethyl)phenyl]-1-propylpiperidin-4-ol |
|---|---|
| PubChem CID | 11493508 |
| Molecular Formula | C15H19ClF3NO |
| Molecular Weight | 321.77 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 4-[4-chloro-3-(trifluoromethyl)phenyl]-1-propylpiperidin-4-ol |
| SMILES | CCCN1CCC(O)(c2ccc(Cl)c(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C15H19ClF3NO/c1-2-7-20-8-5-14(21,6-9-20)11-3-4-13(16)12(10-11)15(17,18)19/h3-4,10,21H,2,5-9H2,1H3 |
| InChIKey | FCYIEMNNKAWJFU-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.77 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |