C16H15ClFNO3 — CID 11493541
N-(3-chloro-4-fluorophenyl)-6,6-dimethyl-2,4-dioxobicyclo[3.1.1]heptane-3-carboxamide (PubChem CID 11493541) has the molecular formula C16H15ClFNO3 and a molecular weight of 323.75 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-6,6-dimethyl-2,4-dioxobicyclo[3.1.1]heptane-3-carboxamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-6,6-dimethyl-2,4-dioxobicyclo[3.1.1]heptane-3-carboxamide |
|---|---|
| PubChem CID | 11493541 |
| Molecular Formula | C16H15ClFNO3 |
| Molecular Weight | 323.75 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-6,6-dimethyl-2,4-dioxobicyclo[3.1.1]heptane-3-carboxamide |
| SMILES | CC1(C)C2CC1C(=O)C(C(=O)Nc1ccc(F)c(Cl)c1)C2=O |
| InChI | InChI=1S/C16H15ClFNO3/c1-16(2)8-6-9(16)14(21)12(13(8)20)15(22)19-7-3-4-11(18)10(17)5-7/h3-5,8-9,12H,6H2,1-2H3,(H,19,22) |
| InChIKey | NITSKFYBMVPWSP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.75 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|