C16H17ClFNO3 — CID 11529926
N-(3-chloro-4-fluorophenyl)-4-ethyl-4-methyl-2,6-dioxocyclohexane-1-carboxamide (PubChem CID 11529926) has the molecular formula C16H17ClFNO3 and a molecular weight of 325.77 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-4-ethyl-4-methyl-2,6-dioxocyclohexane-1-carboxamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-4-ethyl-4-methyl-2,6-dioxocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 11529926 |
| Molecular Formula | C16H17ClFNO3 |
| Molecular Weight | 325.77 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-4-ethyl-4-methyl-2,6-dioxocyclohexane-1-carboxamide |
| SMILES | CCC1(C)CC(=O)C(C(=O)Nc2ccc(F)c(Cl)c2)C(=O)C1 |
| InChI | InChI=1S/C16H17ClFNO3/c1-3-16(2)7-12(20)14(13(21)8-16)15(22)19-9-4-5-11(18)10(17)6-9/h4-6,14H,3,7-8H2,1-2H3,(H,19,22) |
| InChIKey | POLSZCFKMGRVGJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.77 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|