C19H34O4 — CID 11493590
methyl 2-[(3S,4R,6S)-4,6-diethyl-6-[(E,2R)-2-ethylhex-3-enyl]dioxan-3-yl]acetate (PubChem CID 11493590) has the molecular formula C19H34O4 and a molecular weight of 326.48 g/mol. Its IUPAC name is methyl 2-[(3S,4R,6S)-4,6-diethyl-6-[(E,2R)-2-ethylhex-3-enyl]dioxan-3-yl]acetate.
| Compound Name | methyl 2-[(3S,4R,6S)-4,6-diethyl-6-[(E,2R)-2-ethylhex-3-enyl]dioxan-3-yl]acetate |
|---|---|
| PubChem CID | 11493590 |
| Molecular Formula | C19H34O4 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.25 |
| IUPAC Name | methyl 2-[(3S,4R,6S)-4,6-diethyl-6-[(E,2R)-2-ethylhex-3-enyl]dioxan-3-yl]acetate |
| SMILES | CC/C=C/[C@H](CC)C[C@@]1(CC)C[C@@H](CC)[C@H](CC(=O)OC)OO1 |
| InChI | InChI=1S/C19H34O4/c1-6-10-11-15(7-2)13-19(9-4)14-16(8-3)17(22-23-19)12-18(20)21-5/h10-11,15-17H,6-9,12-14H2,1-5H3/b11-10+/t15-,16+,17-,19-/m0/s1 |
| InChIKey | YKVQDPOTKZFVCV-TYQYTZKLSA-N |
| XLogP | 4.83 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|