C16H19N3O2 — CID 114936559
3-[(6-methoxy-3-pyridinyl)methylamino]-N,2-dimethylbenzamide (PubChem CID 114936559) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is 3-[(6-methoxy-3-pyridinyl)methylamino]-N,2-dimethylbenzamide.
| Compound Name | 3-[(6-methoxy-3-pyridinyl)methylamino]-N,2-dimethylbenzamide |
|---|---|
| PubChem CID | 114936559 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 3-[(6-methoxy-3-pyridinyl)methylamino]-N,2-dimethylbenzamide |
| SMILES | CNC(=O)c1cccc(NCc2ccc(OC)nc2)c1C |
| InChI | InChI=1S/C16H19N3O2/c1-11-13(16(20)17-2)5-4-6-14(11)18-9-12-7-8-15(21-3)19-10-12/h4-8,10,18H,9H2,1-3H3,(H,17,20) |
| InChIKey | BTMVHUFTXBMAOA-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |