C12H21N3O — CID 114937202
N-butan-2-yl-1-(6-methoxy-3-pyridinyl)ethane-1,2-diamine (PubChem CID 114937202) has the molecular formula C12H21N3O and a molecular weight of 223.32 g/mol. Its IUPAC name is N-butan-2-yl-1-(6-methoxy-3-pyridinyl)ethane-1,2-diamine.
| Compound Name | N-butan-2-yl-1-(6-methoxy-3-pyridinyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 114937202 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | N-butan-2-yl-1-(6-methoxy-3-pyridinyl)ethane-1,2-diamine |
| SMILES | CCC(C)NC(CN)c1ccc(OC)nc1 |
| InChI | InChI=1S/C12H21N3O/c1-4-9(2)15-11(7-13)10-5-6-12(16-3)14-8-10/h5-6,8-9,11,15H,4,7,13H2,1-3H3 |
| InChIKey | VOAWYICYCRSEHH-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |