C11H17N3O — CID 114937199
1-(6-methoxy-3-pyridinyl)-N-prop-2-enylethane-1,2-diamine (PubChem CID 114937199) has the molecular formula C11H17N3O and a molecular weight of 207.28 g/mol. Its IUPAC name is 1-(6-methoxy-3-pyridinyl)-N-prop-2-enylethane-1,2-diamine.
| Compound Name | 1-(6-methoxy-3-pyridinyl)-N-prop-2-enylethane-1,2-diamine |
|---|---|
| PubChem CID | 114937199 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 1-(6-methoxy-3-pyridinyl)-N-prop-2-enylethane-1,2-diamine |
| SMILES | C=CCNC(CN)c1ccc(OC)nc1 |
| InChI | InChI=1S/C11H17N3O/c1-3-6-13-10(7-12)9-4-5-11(15-2)14-8-9/h3-5,8,10,13H,1,6-7,12H2,2H3 |
| InChIKey | KENIXMABPXODAG-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|