C11H18N2O2 — CID 114938137
2-(6-methoxy-3-pyridinyl)-2-(propylamino)ethanol (PubChem CID 114938137) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 2-(6-methoxy-3-pyridinyl)-2-(propylamino)ethanol.
| Compound Name | 2-(6-methoxy-3-pyridinyl)-2-(propylamino)ethanol |
|---|---|
| PubChem CID | 114938137 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 2-(6-methoxy-3-pyridinyl)-2-(propylamino)ethanol |
| SMILES | CCCNC(CO)c1ccc(OC)nc1 |
| InChI | InChI=1S/C11H18N2O2/c1-3-6-12-10(8-14)9-4-5-11(15-2)13-7-9/h4-5,7,10,12,14H,3,6,8H2,1-2H3 |
| InChIKey | ZMCYUKQAQQQESU-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |