C11H13N3O — CID 114937308
2-(cyclopropylamino)-2-(6-methoxy-3-pyridinyl)acetonitrile (PubChem CID 114937308) has the molecular formula C11H13N3O and a molecular weight of 203.25 g/mol. Its IUPAC name is 2-(cyclopropylamino)-2-(6-methoxy-3-pyridinyl)acetonitrile.
| Compound Name | 2-(cyclopropylamino)-2-(6-methoxy-3-pyridinyl)acetonitrile |
|---|---|
| PubChem CID | 114937308 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 2-(cyclopropylamino)-2-(6-methoxy-3-pyridinyl)acetonitrile |
| SMILES | COc1ccc(C(C#N)NC2CC2)cn1 |
| InChI | InChI=1S/C11H13N3O/c1-15-11-5-2-8(7-13-11)10(6-12)14-9-3-4-9/h2,5,7,9-10,14H,3-4H2,1H3 |
| InChIKey | JITXPLNMQYVJNI-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |