C19H22O — CID 114939059
1-(1,2-dihydroacenaphthylen-5-yl)heptan-1-one (PubChem CID 114939059) has the molecular formula C19H22O and a molecular weight of 266.38 g/mol. Its IUPAC name is 1-(1,2-dihydroacenaphthylen-5-yl)heptan-1-one.
| Compound Name | 1-(1,2-dihydroacenaphthylen-5-yl)heptan-1-one |
|---|---|
| PubChem CID | 114939059 |
| Molecular Formula | C19H22O |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 1-(1,2-dihydroacenaphthylen-5-yl)heptan-1-one |
| SMILES | CCCCCCC(=O)c1ccc2c3c(cccc13)CC2 |
| InChI | InChI=1S/C19H22O/c1-2-3-4-5-9-18(20)16-13-12-15-11-10-14-7-6-8-17(16)19(14)15/h6-8,12-13H,2-5,9-11H2,1H3 |
| InChIKey | FQFFWWNDHZUVSW-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|