C19H20O2 — CID 114939092
1-(1,2-dihydroacenaphthylen-5-yl)-3-(oxolan-2-yl)propan-1-one (PubChem CID 114939092) has the molecular formula C19H20O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is 1-(1,2-dihydroacenaphthylen-5-yl)-3-(oxolan-2-yl)propan-1-one.
| Compound Name | 1-(1,2-dihydroacenaphthylen-5-yl)-3-(oxolan-2-yl)propan-1-one |
|---|---|
| PubChem CID | 114939092 |
| Molecular Formula | C19H20O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 1-(1,2-dihydroacenaphthylen-5-yl)-3-(oxolan-2-yl)propan-1-one |
| SMILES | O=C(CCC1CCCO1)c1ccc2c3c(cccc13)CC2 |
| InChI | InChI=1S/C19H20O2/c20-18(11-9-15-4-2-12-21-15)16-10-8-14-7-6-13-3-1-5-17(16)19(13)14/h1,3,5,8,10,15H,2,4,6-7,9,11-12H2 |
| InChIKey | YDERNNZTKZNYKN-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |