C24H22NO2 — CID 11494152
CID 11494152 (PubChem CID 11494152) has the molecular formula C24H22NO2 and a molecular weight of 356.45 g/mol.
| Compound Name | CID 11494152 |
|---|---|
| PubChem CID | 11494152 |
| Molecular Formula | C24H22NO2 |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | — |
| SMILES | COc1ccc(N2C(=O)CCC2[C](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H22NO2/c1-27-21-14-12-20(13-15-21)25-22(16-17-23(25)26)24(18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-15,22H,16-17H2,1H3 |
| InChIKey | DSMGBXWQUITWCK-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |