C21H22O7 — CID 11494753
3-(2,3-dihydroxy-4-methoxyphenyl)-3,7-dihydroxy-8-(3-methylbut-2-enyl)-2H-chromen-4-one (PubChem CID 11494753) has the molecular formula C21H22O7 and a molecular weight of 386.40 g/mol. Its IUPAC name is 3-(2,3-dihydroxy-4-methoxyphenyl)-3,7-dihydroxy-8-(3-methylbut-2-enyl)-2H-chromen-4-one.
| Compound Name | 3-(2,3-dihydroxy-4-methoxyphenyl)-3,7-dihydroxy-8-(3-methylbut-2-enyl)-2H-chromen-4-one |
|---|---|
| PubChem CID | 11494753 |
| Molecular Formula | C21H22O7 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 3-(2,3-dihydroxy-4-methoxyphenyl)-3,7-dihydroxy-8-(3-methylbut-2-enyl)-2H-chromen-4-one |
| SMILES | COc1ccc(C2(O)COc3c(ccc(O)c3CC=C(C)C)C2=O)c(O)c1O |
| InChI | InChI=1S/C21H22O7/c1-11(2)4-5-12-15(22)8-6-13-19(12)28-10-21(26,20(13)25)14-7-9-16(27-3)18(24)17(14)23/h4,6-9,22-24,26H,5,10H2,1-3H3 |
| InChIKey | RWAFKANBZVVJAJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|