C14H19FN2O4 — CID 114947704
5-amino-2-fluoro-4-[(4-hydroxyoxan-4-yl)methyl-methylamino]benzoic acid (PubChem CID 114947704) has the molecular formula C14H19FN2O4 and a molecular weight of 298.31 g/mol. Its IUPAC name is 5-amino-2-fluoro-4-[(4-hydroxyoxan-4-yl)methyl-methylamino]benzoic acid.
| Compound Name | 5-amino-2-fluoro-4-[(4-hydroxyoxan-4-yl)methyl-methylamino]benzoic acid |
|---|---|
| PubChem CID | 114947704 |
| Molecular Formula | C14H19FN2O4 |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 5-amino-2-fluoro-4-[(4-hydroxyoxan-4-yl)methyl-methylamino]benzoic acid |
| SMILES | CN(CC1(O)CCOCC1)c1cc(F)c(C(=O)O)cc1N |
| InChI | InChI=1S/C14H19FN2O4/c1-17(8-14(20)2-4-21-5-3-14)12-7-10(15)9(13(18)19)6-11(12)16/h6-7,20H,2-5,8,16H2,1H3,(H,18,19) |
| InChIKey | JSFGCKGGBYHZIQ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|