C13H19ClFN3O2 — CID 103553535
4-[(4,6-diamino-3-chloro-2-fluoro-N-methylanilino)methyl]oxan-4-ol (PubChem CID 103553535) has the molecular formula C13H19ClFN3O2 and a molecular weight of 303.76 g/mol. Its IUPAC name is 4-[(4,6-diamino-3-chloro-2-fluoro-N-methylanilino)methyl]oxan-4-ol.
| Compound Name | 4-[(4,6-diamino-3-chloro-2-fluoro-N-methylanilino)methyl]oxan-4-ol |
|---|---|
| PubChem CID | 103553535 |
| Molecular Formula | C13H19ClFN3O2 |
| Molecular Weight | 303.76 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 4-[(4,6-diamino-3-chloro-2-fluoro-N-methylanilino)methyl]oxan-4-ol |
| SMILES | CN(CC1(O)CCOCC1)c1c(N)cc(N)c(Cl)c1F |
| InChI | InChI=1S/C13H19ClFN3O2/c1-18(7-13(19)2-4-20-5-3-13)12-9(17)6-8(16)10(14)11(12)15/h6,19H,2-5,7,16-17H2,1H3 |
| InChIKey | DJJLIOVONHIPOF-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 84.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.76 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|