C14H25F3N2O — CID 114948246
7,7-dimethyl-6-[(5,5,5-trifluoropentylamino)methyl]-2-oxabicyclo[3.2.0]heptan-6-amine (PubChem CID 114948246) has the molecular formula C14H25F3N2O and a molecular weight of 294.36 g/mol. Its IUPAC name is 7,7-dimethyl-6-[(5,5,5-trifluoropentylamino)methyl]-2-oxabicyclo[3.2.0]heptan-6-amine.
| Compound Name | 7,7-dimethyl-6-[(5,5,5-trifluoropentylamino)methyl]-2-oxabicyclo[3.2.0]heptan-6-amine |
|---|---|
| PubChem CID | 114948246 |
| Molecular Formula | C14H25F3N2O |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | 7,7-dimethyl-6-[(5,5,5-trifluoropentylamino)methyl]-2-oxabicyclo[3.2.0]heptan-6-amine |
| SMILES | CC1(C)C2OCCC2C1(N)CNCCCCC(F)(F)F |
| InChI | InChI=1S/C14H25F3N2O/c1-12(2)11-10(5-8-20-11)13(12,18)9-19-7-4-3-6-14(15,16)17/h10-11,19H,3-9,18H2,1-2H3 |
| InChIKey | ZOZNUYUUGGQKMT-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|