C12H20N4O4 — CID 114950235
1-[2-[(4-hydroxyoxan-4-yl)methyl-methylamino]ethyl]triazole-4-carboxylic acid (PubChem CID 114950235) has the molecular formula C12H20N4O4 and a molecular weight of 284.32 g/mol. Its IUPAC name is 1-[2-[(4-hydroxyoxan-4-yl)methyl-methylamino]ethyl]triazole-4-carboxylic acid.
| Compound Name | 1-[2-[(4-hydroxyoxan-4-yl)methyl-methylamino]ethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 114950235 |
| Molecular Formula | C12H20N4O4 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 1-[2-[(4-hydroxyoxan-4-yl)methyl-methylamino]ethyl]triazole-4-carboxylic acid |
| SMILES | CN(CCn1cc(C(=O)O)nn1)CC1(O)CCOCC1 |
| InChI | InChI=1S/C12H20N4O4/c1-15(9-12(19)2-6-20-7-3-12)4-5-16-8-10(11(17)18)13-14-16/h8,19H,2-7,9H2,1H3,(H,17,18) |
| InChIKey | JLCVNRWEAUNVQD-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 100.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |