C12H15N5O2 — CID 43564382
1-[2-[methyl(pyridin-4-ylmethyl)amino]ethyl]triazole-4-carboxylic acid (PubChem CID 43564382) has the molecular formula C12H15N5O2 and a molecular weight of 261.29 g/mol. Its IUPAC name is 1-[2-[methyl(pyridin-4-ylmethyl)amino]ethyl]triazole-4-carboxylic acid.
| Compound Name | 1-[2-[methyl(pyridin-4-ylmethyl)amino]ethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 43564382 |
| Molecular Formula | C12H15N5O2 |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 1-[2-[methyl(pyridin-4-ylmethyl)amino]ethyl]triazole-4-carboxylic acid |
| SMILES | CN(CCn1cc(C(=O)O)nn1)Cc1ccncc1 |
| InChI | InChI=1S/C12H15N5O2/c1-16(8-10-2-4-13-5-3-10)6-7-17-9-11(12(18)19)14-15-17/h2-5,9H,6-8H2,1H3,(H,18,19) |
| InChIKey | UPWINDYDEGCNJC-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |