C13H15N5O3 — CID 66290154
1-[2-[ethyl(pyridin-4-ylmethyl)amino]-2-oxoethyl]triazole-4-carboxylic acid (PubChem CID 66290154) has the molecular formula C13H15N5O3 and a molecular weight of 289.30 g/mol. Its IUPAC name is 1-[2-[ethyl(pyridin-4-ylmethyl)amino]-2-oxoethyl]triazole-4-carboxylic acid.
| Compound Name | 1-[2-[ethyl(pyridin-4-ylmethyl)amino]-2-oxoethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 66290154 |
| Molecular Formula | C13H15N5O3 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 1-[2-[ethyl(pyridin-4-ylmethyl)amino]-2-oxoethyl]triazole-4-carboxylic acid |
| SMILES | CCN(Cc1ccncc1)C(=O)Cn1cc(C(=O)O)nn1 |
| InChI | InChI=1S/C13H15N5O3/c1-2-17(7-10-3-5-14-6-4-10)12(19)9-18-8-11(13(20)21)15-16-18/h3-6,8H,2,7,9H2,1H3,(H,20,21) |
| InChIKey | ZDETXDIDEISDGN-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |