C14H20Cl2N2O — CID 114952614
1-[[(2,4-dichloro-6-methyl-3-pyridinyl)methyl-methylamino]methyl]cyclopentan-1-ol (PubChem CID 114952614) has the molecular formula C14H20Cl2N2O and a molecular weight of 303.23 g/mol. Its IUPAC name is 1-[[(2,4-dichloro-6-methyl-3-pyridinyl)methyl-methylamino]methyl]cyclopentan-1-ol.
| Compound Name | 1-[[(2,4-dichloro-6-methyl-3-pyridinyl)methyl-methylamino]methyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 114952614 |
| Molecular Formula | C14H20Cl2N2O |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 1-[[(2,4-dichloro-6-methyl-3-pyridinyl)methyl-methylamino]methyl]cyclopentan-1-ol |
| SMILES | Cc1cc(Cl)c(CN(C)CC2(O)CCCC2)c(Cl)n1 |
| InChI | InChI=1S/C14H20Cl2N2O/c1-10-7-12(15)11(13(16)17-10)8-18(2)9-14(19)5-3-4-6-14/h7,19H,3-6,8-9H2,1-2H3 |
| InChIKey | SJJQAYXCDALPJD-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|