C9H16F3NO2 — CID 114952655
4-[[methyl(2,2,2-trifluoroethyl)amino]methyl]oxan-4-ol (PubChem CID 114952655) has the molecular formula C9H16F3NO2 and a molecular weight of 227.23 g/mol. Its IUPAC name is 4-[[methyl(2,2,2-trifluoroethyl)amino]methyl]oxan-4-ol.
| Compound Name | 4-[[methyl(2,2,2-trifluoroethyl)amino]methyl]oxan-4-ol |
|---|---|
| PubChem CID | 114952655 |
| Molecular Formula | C9H16F3NO2 |
| Molecular Weight | 227.23 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 4-[[methyl(2,2,2-trifluoroethyl)amino]methyl]oxan-4-ol |
| SMILES | CN(CC(F)(F)F)CC1(O)CCOCC1 |
| InChI | InChI=1S/C9H16F3NO2/c1-13(7-9(10,11)12)6-8(14)2-4-15-5-3-8/h14H,2-7H2,1H3 |
| InChIKey | ZOLOIQJSKPACMF-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.23 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |