C11H20F3NO2 — CID 114952838
4-[[methyl(4,4,4-trifluorobutyl)amino]methyl]oxan-4-ol (PubChem CID 114952838) has the molecular formula C11H20F3NO2 and a molecular weight of 255.28 g/mol. Its IUPAC name is 4-[[methyl(4,4,4-trifluorobutyl)amino]methyl]oxan-4-ol.
| Compound Name | 4-[[methyl(4,4,4-trifluorobutyl)amino]methyl]oxan-4-ol |
|---|---|
| PubChem CID | 114952838 |
| Molecular Formula | C11H20F3NO2 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 4-[[methyl(4,4,4-trifluorobutyl)amino]methyl]oxan-4-ol |
| SMILES | CN(CCCC(F)(F)F)CC1(O)CCOCC1 |
| InChI | InChI=1S/C11H20F3NO2/c1-15(6-2-3-11(12,13)14)9-10(16)4-7-17-8-5-10/h16H,2-9H2,1H3 |
| InChIKey | YSKXEDGOWBCGTB-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |