C15H24N2O3S — CID 114952955
2-[(4-hydroxyoxan-4-yl)methyl-methylamino]-N-(2-thiophen-2-ylethyl)acetamide (PubChem CID 114952955) has the molecular formula C15H24N2O3S and a molecular weight of 312.43 g/mol. Its IUPAC name is 2-[(4-hydroxyoxan-4-yl)methyl-methylamino]-N-(2-thiophen-2-ylethyl)acetamide.
| Compound Name | 2-[(4-hydroxyoxan-4-yl)methyl-methylamino]-N-(2-thiophen-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 114952955 |
| Molecular Formula | C15H24N2O3S |
| Molecular Weight | 312.43 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 2-[(4-hydroxyoxan-4-yl)methyl-methylamino]-N-(2-thiophen-2-ylethyl)acetamide |
| SMILES | CN(CC(=O)NCCc1cccs1)CC1(O)CCOCC1 |
| InChI | InChI=1S/C15H24N2O3S/c1-17(12-15(19)5-8-20-9-6-15)11-14(18)16-7-4-13-3-2-10-21-13/h2-3,10,19H,4-9,11-12H2,1H3,(H,16,18) |
| InChIKey | QSFJJLMLMKMCPZ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.43 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |