C14H23N3O2 — CID 114953250
4-[[methyl-[[2-(methylamino)-4-pyridinyl]methyl]amino]methyl]oxan-4-ol (PubChem CID 114953250) has the molecular formula C14H23N3O2 and a molecular weight of 265.36 g/mol. Its IUPAC name is 4-[[methyl-[[2-(methylamino)-4-pyridinyl]methyl]amino]methyl]oxan-4-ol.
| Compound Name | 4-[[methyl-[[2-(methylamino)-4-pyridinyl]methyl]amino]methyl]oxan-4-ol |
|---|---|
| PubChem CID | 114953250 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 4-[[methyl-[[2-(methylamino)-4-pyridinyl]methyl]amino]methyl]oxan-4-ol |
| SMILES | CNc1cc(CN(C)CC2(O)CCOCC2)ccn1 |
| InChI | InChI=1S/C14H23N3O2/c1-15-13-9-12(3-6-16-13)10-17(2)11-14(18)4-7-19-8-5-14/h3,6,9,18H,4-5,7-8,10-11H2,1-2H3,(H,15,16) |
| InChIKey | BZXHEJGVYACWDJ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 57.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |