C18H29N3O3 — CID 125013514
4-[[(2S)-2-[2-[2-(methylamino)-4-pyridinyl]ethyl]morpholin-4-yl]methyl]oxan-4-ol (PubChem CID 125013514) has the molecular formula C18H29N3O3 and a molecular weight of 335.45 g/mol. Its IUPAC name is 4-[[(2S)-2-[2-[2-(methylamino)-4-pyridinyl]ethyl]morpholin-4-yl]methyl]oxan-4-ol.
| Compound Name | 4-[[(2S)-2-[2-[2-(methylamino)-4-pyridinyl]ethyl]morpholin-4-yl]methyl]oxan-4-ol |
|---|---|
| PubChem CID | 125013514 |
| Molecular Formula | C18H29N3O3 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | 4-[[(2S)-2-[2-[2-(methylamino)-4-pyridinyl]ethyl]morpholin-4-yl]methyl]oxan-4-ol |
| SMILES | CNc1cc(CC[C@H]2CN(CC3(O)CCOCC3)CCO2)ccn1 |
| InChI | InChI=1S/C18H29N3O3/c1-19-17-12-15(4-7-20-17)2-3-16-13-21(8-11-24-16)14-18(22)5-9-23-10-6-18/h4,7,12,16,22H,2-3,5-6,8-11,13-14H2,1H3,(H,19,20)/t16-/m0/s1 |
| InChIKey | WFUBPJJASGJLGG-INIZCTEOSA-N |
| XLogP | 1.30 |
| TPSA | 66.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |