C14H12FN3O2S — CID 114956176
2-cyano-3-fluoro-N-[(4-methyl-3-pyridinyl)methyl]benzenesulfonamide (PubChem CID 114956176) has the molecular formula C14H12FN3O2S and a molecular weight of 305.33 g/mol. Its IUPAC name is 2-cyano-3-fluoro-N-[(4-methyl-3-pyridinyl)methyl]benzenesulfonamide.
| Compound Name | 2-cyano-3-fluoro-N-[(4-methyl-3-pyridinyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 114956176 |
| Molecular Formula | C14H12FN3O2S |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 2-cyano-3-fluoro-N-[(4-methyl-3-pyridinyl)methyl]benzenesulfonamide |
| SMILES | Cc1ccncc1CNS(=O)(=O)c1cccc(F)c1C#N |
| InChI | InChI=1S/C14H12FN3O2S/c1-10-5-6-17-8-11(10)9-18-21(19,20)14-4-2-3-13(15)12(14)7-16/h2-6,8,18H,9H2,1H3 |
| InChIKey | USUGEYUKKAJTLP-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |