C6H14N2O4S — CID 114958849
2-[ethyl(sulfamoyl)amino]-2-methylpropanoic acid (PubChem CID 114958849) has the molecular formula C6H14N2O4S and a molecular weight of 210.25 g/mol. Its IUPAC name is 2-[ethyl(sulfamoyl)amino]-2-methylpropanoic acid.
| Compound Name | 2-[ethyl(sulfamoyl)amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 114958849 |
| Molecular Formula | C6H14N2O4S |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | 2-[ethyl(sulfamoyl)amino]-2-methylpropanoic acid |
| SMILES | CCN(C(C)(C)C(=O)O)S(N)(=O)=O |
| InChI | InChI=1S/C6H14N2O4S/c1-4-8(13(7,11)12)6(2,3)5(9)10/h4H2,1-3H3,(H,9,10)(H2,7,11,12) |
| InChIKey | WBTSHVIGYFMHLR-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |