C11H21NO6S — CID 62818554
2-[(3-ethoxy-3-oxopropyl)sulfonyl-ethylamino]-2-methylpropanoic acid (PubChem CID 62818554) has the molecular formula C11H21NO6S and a molecular weight of 295.36 g/mol. Its IUPAC name is 2-[(3-ethoxy-3-oxopropyl)sulfonyl-ethylamino]-2-methylpropanoic acid.
| Compound Name | 2-[(3-ethoxy-3-oxopropyl)sulfonyl-ethylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 62818554 |
| Molecular Formula | C11H21NO6S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 2-[(3-ethoxy-3-oxopropyl)sulfonyl-ethylamino]-2-methylpropanoic acid |
| SMILES | CCOC(=O)CCS(=O)(=O)N(CC)C(C)(C)C(=O)O |
| InChI | InChI=1S/C11H21NO6S/c1-5-12(11(3,4)10(14)15)19(16,17)8-7-9(13)18-6-2/h5-8H2,1-4H3,(H,14,15) |
| InChIKey | IZKGVOPYYOFFKM-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |