C7H16N4O2S2 — CID 114959183
2-(4-sulfamoylpiperazin-1-yl)propanethioamide (PubChem CID 114959183) has the molecular formula C7H16N4O2S2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 2-(4-sulfamoylpiperazin-1-yl)propanethioamide.
| Compound Name | 2-(4-sulfamoylpiperazin-1-yl)propanethioamide |
|---|---|
| PubChem CID | 114959183 |
| Molecular Formula | C7H16N4O2S2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 2-(4-sulfamoylpiperazin-1-yl)propanethioamide |
| SMILES | CC(C(N)=S)N1CCN(S(N)(=O)=O)CC1 |
| InChI | InChI=1S/C7H16N4O2S2/c1-6(7(8)14)10-2-4-11(5-3-10)15(9,12)13/h6H,2-5H2,1H3,(H2,8,14)(H2,9,12,13) |
| InChIKey | BOOBFJZEHLUDBT-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 92.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|