C18H16ClN3O2 — CID 11496228
N-(4-chlorophenyl)-6,7-dimethoxy-1,4-dihydroindeno[2,1-d]pyrazol-3-amine (PubChem CID 11496228) has the molecular formula C18H16ClN3O2 and a molecular weight of 341.80 g/mol. Its IUPAC name is N-(4-chlorophenyl)-6,7-dimethoxy-1,4-dihydroindeno[2,1-d]pyrazol-3-amine.
| Compound Name | N-(4-chlorophenyl)-6,7-dimethoxy-1,4-dihydroindeno[2,1-d]pyrazol-3-amine |
|---|---|
| PubChem CID | 11496228 |
| Molecular Formula | C18H16ClN3O2 |
| Molecular Weight | 341.80 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | N-(4-chlorophenyl)-6,7-dimethoxy-1,4-dihydroindeno[2,1-d]pyrazol-3-amine |
| SMILES | COc1cc2c(cc1OC)-c1[nH]nc(Nc3ccc(Cl)cc3)c1C2 |
| InChI | InChI=1S/C18H16ClN3O2/c1-23-15-8-10-7-14-17(13(10)9-16(15)24-2)21-22-18(14)20-12-5-3-11(19)4-6-12/h3-6,8-9H,7H2,1-2H3,(H2,20,21,22) |
| InChIKey | XRRBNRLNVPJQKM-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 59.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.80 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |