C14H14F2N2O — CID 114963861
(2,4-difluoro-5-methylphenyl)-(1-propylpyrazol-4-yl)methanone (PubChem CID 114963861) has the molecular formula C14H14F2N2O and a molecular weight of 264.28 g/mol. Its IUPAC name is (2,4-difluoro-5-methylphenyl)-(1-propylpyrazol-4-yl)methanone.
| Compound Name | (2,4-difluoro-5-methylphenyl)-(1-propylpyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 114963861 |
| Molecular Formula | C14H14F2N2O |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | (2,4-difluoro-5-methylphenyl)-(1-propylpyrazol-4-yl)methanone |
| SMILES | CCCn1cc(C(=O)c2cc(C)c(F)cc2F)cn1 |
| InChI | InChI=1S/C14H14F2N2O/c1-3-4-18-8-10(7-17-18)14(19)11-5-9(2)12(15)6-13(11)16/h5-8H,3-4H2,1-2H3 |
| InChIKey | RBKZEESFOCUFHG-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |